subroutine res_cs(jres, icon, iob) !rtb cs !! ~ ~ ~ PURPOSE ~ ~ ~ !! this subroutine computes the reservoir constituent mass balance use reservoir_data_module use reservoir_module use water_body_module use hydrograph_module, only : res, resz, ob, ht2, wbody use constituent_mass_module use res_cs_module use climate_module use cs_data_module implicit none integer, intent (in) :: iob integer :: jres !reservoir number (incoming) integer :: icon !none |counter integer :: iwst = 0 !none |weather station number integer :: ics = 0 !constituent counter real :: cs_mass = 0. !mass of constituent in reservoir water (kg) real :: cs_mass_out = 0. !mass of constituent leaving the reservoir via outflow (kg) real :: cs_conc = 0. !concentration of constituent in reservoir water (g/m3 = mg/L) integer :: icmd = 0 !none real :: k_react = 0. !1/day - first-order rate constant, affected by temperature real :: v_settle = 0. !m/day - settling rate real :: cs_mass_beg = 0. real :: cs_conc_beg = 0. real :: cs_mass_end = 0. real :: cs_conc_end = 0. real :: cs_inflow = 0. real :: cs_outflow = 0. real :: cs_seep = 0. real :: cs_settle = 0. real :: cs_rctn = 0. real :: cs_prod = 0. real :: seo4_convert = 0. !kg |mass of seo4 converted to seo3 real :: theta !temperature factor for chemical reactions real :: mass_avail = 0. !track available constituent mass in the reservoir (kg) !object number icmd = res_ob(jres)%ob !mass balance output (by reservoir): prepare by setting to 0 do ics=1,cs_db%num_cs rescs_d(jres)%cs(ics)%inflow = 0. rescs_d(jres)%cs(ics)%outflow = 0. rescs_d(jres)%cs(ics)%seep = 0. rescs_d(jres)%cs(ics)%settle = 0. rescs_d(jres)%cs(ics)%rctn = 0. rescs_d(jres)%cs(ics)%irrig = 0. rescs_d(jres)%cs(ics)%mass = 0. rescs_d(jres)%cs(ics)%conc = 0. enddo !only proceed if the reservoir has more than 1 m3 of water if (res(jres)%flo > 1.) then !loop through the constituents seo4_convert = 0. do ics=1,cs_db%num_cs !constituent mass and concentration at beginning of day cs_mass_beg = res_water(jres)%cs(ics) !kg cs_conc_beg = res_water(jres)%csc(ics) !g/m3 mass_avail = cs_mass_beg !constituent mass entering reservoir cs_inflow = obcs(icmd)%hin(1)%cs(ics) !kg mass_avail = mass_avail + cs_inflow !constituent mass leaving reservoir via stream outflow cs_outflow = (ht2%flo * cs_conc_beg) / 1000. !m3 * g/m3 = g --> kg if(cs_outflow > mass_avail) then cs_outflow = mass_avail !take remaining endif mass_avail = mass_avail - cs_outflow !constituent mass leaving reservoir via seepage cs_seep = (res_wat_d(jres)%seep * cs_conc_beg) / 1000. !m3 * g/m3 = g --> kg if(cs_seep > mass_avail) then cs_seep = mass_avail !take remaining endif mass_avail = mass_avail - cs_seep !constituent mass settling to bottom of reservoir if(ics == 1) then v_settle = res_cs_data(icon)%v_seo4 elseif(ics == 2) then v_settle = res_cs_data(icon)%v_seo3 elseif(ics == 3) then v_settle = res_cs_data(icon)%v_born endif cs_settle = (cs_conc_beg/1000.) * v_settle * (res_wat_d(jres)%area_ha*10000.) !kg if(cs_settle > mass_avail) then cs_settle = mass_avail !take remaining endif mass_avail = mass_avail - cs_settle !constituent mass removed via first-order chemical reaction !(first-order rate constant dependent on temperature) iwst = ob(iob)%wst if(ics == 1) then !seo4 k_react = theta(res_cs_data(icon)%k_seo4, res_cs_data(icon)%theta_seo4, wst(iwst)%weat%tave) elseif(ics == 2) then !seo3 k_react = theta(res_cs_data(icon)%k_seo3, res_cs_data(icon)%theta_seo3, wst(iwst)%weat%tave) elseif(ics == 3) then !boron k_react = theta(res_cs_data(icon)%k_born, res_cs_data(icon)%theta_born, wst(iwst)%weat%tave) endif cs_rctn = (cs_conc_beg/1000.) * k_react * res(jres)%flo !kg if(cs_rctn > mass_avail) then cs_rctn = mass_avail !take remaining endif if(ics == 1) then !seo4 - save for seo3 production seo4_convert = cs_rctn endif mass_avail = mass_avail - cs_rctn !seo3 mass produced via seo4 reduction (seo4-->seo3) cs_prod = 0. if(ics == 2) then !seo3 (seo4 --> seo3) cs_prod = seo4_convert mass_avail = mass_avail + cs_prod endif !calculate new seo4 mass and concentration in reservoir water at end of day cs_mass_end = cs_mass_beg + (cs_inflow - cs_outflow - cs_seep - cs_settle - cs_rctn + cs_prod) !kg cs_conc_end = (cs_mass_end * 1000.) / res(jres)%flo !g/m3 !store in arrays res_water(jres)%cs(ics) = cs_mass_end !kg res_water(jres)%csc(ics) = cs_conc_end !g/m3 !store constituent balance terms (kg) for output rescs_d(jres)%cs(ics)%inflow = cs_inflow rescs_d(jres)%cs(ics)%outflow = cs_outflow rescs_d(jres)%cs(ics)%seep = cs_seep rescs_d(jres)%cs(ics)%settle = cs_settle rescs_d(jres)%cs(ics)%rctn = cs_rctn rescs_d(jres)%cs(ics)%prod = cs_prod rescs_d(jres)%cs(ics)%mass = cs_mass_end rescs_d(jres)%cs(ics)%conc = cs_conc_end rescs_d(jres)%cs(ics)%volm = res(jres)%flo !set value for outflow (to connect with other objects) obcs(icmd)%hd(1)%cs(ics) = cs_outflow enddo !go to next constituent endif return end subroutine res_cs