aqu_1d_control.f90 Source File


This file depends on

sourcefile~~aqu_1d_control.f90~~EfferentGraph sourcefile~aqu_1d_control.f90 aqu_1d_control.f90 sourcefile~aqu_pesticide_module.f90 aqu_pesticide_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~aqu_pesticide_module.f90 sourcefile~aquifer_module.f90 aquifer_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~aquifer_module.f90 sourcefile~basin_module.f90 basin_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~basin_module.f90 sourcefile~ch_pesticide_module.f90 ch_pesticide_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~ch_pesticide_module.f90 sourcefile~climate_module.f90 climate_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~climate_module.f90 sourcefile~constituent_mass_module.f90 constituent_mass_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~constituent_mass_module.f90 sourcefile~cs_aquifer.f90 cs_aquifer.f90 sourcefile~aqu_1d_control.f90->sourcefile~cs_aquifer.f90 sourcefile~hydrograph_module.f90 hydrograph_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~hydrograph_module.f90 sourcefile~maximum_data_module.f90 maximum_data_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~maximum_data_module.f90 sourcefile~pest_tempdecay_module.f90 pest_tempdecay_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~pest_tempdecay_module.f90 sourcefile~pesticide_data_module.f90 pesticide_data_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~pesticide_data_module.f90 sourcefile~salt_aquifer.f90 salt_aquifer.f90 sourcefile~aqu_1d_control.f90->sourcefile~salt_aquifer.f90 sourcefile~salt_module.f90 salt_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~salt_module.f90 sourcefile~time_module.f90 time_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~time_module.f90 sourcefile~water_allocation_module.f90 water_allocation_module.f90 sourcefile~aqu_1d_control.f90->sourcefile~water_allocation_module.f90 sourcefile~ch_pesticide_module.f90->sourcefile~constituent_mass_module.f90 sourcefile~hydrograph_module.f90->sourcefile~basin_module.f90 sourcefile~hydrograph_module.f90->sourcefile~time_module.f90

Source Code

      subroutine aqu_1d_control 
    
      use aquifer_module
      use time_module
      use hydrograph_module
      use climate_module, only : wst
      use basin_module, only : bsn_prm
      use pest_tempdecay_module, only: decay_temp_adjust
      use maximum_data_module
      use constituent_mass_module
      use pesticide_data_module
      use aqu_pesticide_module
      use salt_module
      use salt_aquifer
      use cs_aquifer
      use ch_pesticide_module
      use water_allocation_module
      
      implicit none
      
      external :: cs_rctn_aqu, cs_sorb_aqu, salt_chem_aqu
      
      integer :: iaq = 0        !none       |counter
      integer :: iaqdb = 0      !           |
      integer :: icha = 0       !           |
      integer :: iob_out = 0    !           !object type out
      integer :: iout = 0       !none       |counter
      integer :: ii = 0         !none       |counter
      integer :: icontrib = 0   !none       |counter
      integer :: ipest = 0      !none       |counter
      integer :: ipest_db = 0   !none       |pesticide number from pesticide data base
      integer :: ipseq = 0      !none       |sequential basin pesticide number
      integer :: ipdb = 0       !none       |seqential pesticide number of daughter pesticide
      integer :: imeta = 0      !none       |pesticide metabolite counter
      real :: mol_wt_rto = 0.   !ratio      |molecular weight ratio of duaghter to parent pesticide
      real :: stor_init = 0.    !           |
      real :: conc_no3 = 0.     !           |
      real :: step = 0.         !           |
      real :: contrib_len = 0.
      real :: contrib_len_left = 0.
      real :: pest_init = 0.    !kg/ha      |amount of pesticide present at beginning of day
      real :: no3_init = 0.     !kg/ha      |amount of nitrate present at beginning of day
      real :: flow_mm = 0.      !mm         |total flow through aquifer - return flow + seepage
      real :: pest_kg = 0.      !kg         |soluble pesticide moving with flow
      real :: conc = 0.         !kg/mm      |concentration of pesticide in flow
      real :: zdb1 = 0.         !mm         |kd - flow factor for pesticide transport
      real :: kd = 0.           !(mg/kg)/(mg/L) |koc * carbon
      real :: gw_volume = 0.    !m3         |m3 of groundwater in aquifer
      real :: salt_recharge = 0.  !kg         |kg of salt in recharge water
      real :: gw_discharge = 0. !m3         |m3 of groundwater discharging to channels
      real :: salt_discharge = 0. !kg         |kg of salt in groundwater discharge
      real :: gw_seep = 0.      !m3         |m3 of groundwater seeping from the aquifer
      real :: salt_seep = 0.    !kg         |kg of salt in groundwater seepage 
      real :: cs_recharge = 0.                 !rtb cs
      real :: cs_discharge = 0.                !rtb cs
      real :: cs_seep = 0.                     !rtb cs
      real :: metab_decay = 0.                 !metabolite decay increment
      real :: temp_aqu = 0.                    !deg C groundwater temperature proxy for decay
      real :: decay_t = 0.                     !temperature-adjusted daily survival factor
      integer :: m = 0!rtb salt
      integer :: ics = 0 !rtb cs
      
      !! set pointers to aquifer database and weather station
      iaq = ob(icmd)%num
      iaqdb = ob(icmd)%props
      iwst = ob(icmd)%wst
      stor_init = aqu_d(iaq)%stor
      
      ob(icmd)%hd(1) = hz
      ob(icmd)%hd(2) = hz
      if (cs_db%num_tot > 0) then
        obcs(icmd)%hd(1) = hin_csz
        obcs(icmd)%hd(2) = hin_csz
      end if

      !convert from m^3 to mm
      aqu_d(iaq)%rchrg = ob(icmd)%hin%flo / (10. * ob(icmd)%area_ha)
      
      !rtb salt
      !calculate salt ion concentrations in groundwater, using salt equilibrium chemistry
      if (cs_db%num_salts > 0) then
        call salt_chem_aqu
      endif
      
      !rtb cs
      !calculate changes in constituent concentration in groundwater due to chemical reactions and sorption
      if (cs_db%num_cs > 0) then
        call cs_rctn_aqu
        call cs_sorb_aqu
      endif
      
      !! lag recharge from bottom of soil to water table ** disabled
      !aqu_d(iaq)%rchrg = (1. - aqu_prm(iaq)%delay_e) * aqu_d(iaq)%rchrg + aqu_prm(iaq)%delay_e * aqu_st(iaq)%rchrg_prev
      
      aqu_prm(iaq)%rchrg_prev = aqu_d(iaq)%rchrg
      
      !! add recharge to aquifer storage
      aqu_d(iaq)%stor = aqu_d(iaq)%stor + aqu_d(iaq)%rchrg
      
      !! if channel is a POD, allocate water for users and adjust flow in channel accordingly
      if (aqu_prm(iaq)%wallo_pod > 0) then
        call wallo_control (aqu_prm(iaq)%wallo_pod)
      end if

      !! compute groundwater depth from surface
      aqu_d(iaq)%dep_wt = aqu_dat(iaq)%dep_bot - (aqu_d(iaq)%stor / (1000. * aqu_dat(iaq)%spyld))
      aqu_d(iaq)%dep_wt = max (0., aqu_d(iaq)%dep_wt)

      !! compute flow and substract from storage
      if (aqu_d(iaq)%dep_wt <= aqu_dat(iaq)%flo_min) then
        aqu_d(iaq)%flo = aqu_d(iaq)%flo * aqu_prm(iaq)%alpha_e + aqu_d(iaq)%rchrg * (1. - aqu_prm(iaq)%alpha_e)
        aqu_d(iaq)%flo = Max (0., aqu_d(iaq)%flo)
        aqu_d(iaq)%flo = Min (aqu_d(iaq)%stor, aqu_d(iaq)%flo)
        aqu_d(iaq)%stor = aqu_d(iaq)%stor - aqu_d(iaq)%flo
      else
        aqu_d(iaq)%flo = 0.
      endif

      !! set hydrograph flow from aquifer- convert mm to m3
      ob(icmd)%hd(1)%flo = 10. * aqu_d(iaq)%flo * ob(icmd)%area_ha
      
      !! compute seepage through aquifer and subtract from storage
      aqu_d(iaq)%seep = aqu_d(iaq)%rchrg * aqu_dat(iaq)%seep
      aqu_d(iaq)%seep = amin1 (aqu_d(iaq)%seep, aqu_d(iaq)%stor)
      ob(icmd)%hd(2)%flo = 10. * aqu_d(iaq)%seep * ob(icmd)%area_ha
      
      aqu_d(iaq)%stor = aqu_d(iaq)%stor - aqu_d(iaq)%seep
      
      !! compute revap (deep root uptake from aquifer) and subtract from storage
      if (aqu_d(iaq)%dep_wt < aqu_dat(iaq)%revap_min) then
        aqu_d(iaq)%revap = wst(iwst)%weat%pet * aqu_dat(iaq)%revap_co
        aqu_d(iaq)%revap = amin1 (aqu_d(iaq)%revap, aqu_d(iaq)%stor)
        aqu_d(iaq)%stor = aqu_d(iaq)%stor - aqu_d(iaq)%revap
      else
        aqu_d(iaq)%revap = 0.
      end if

      !! compute nitrate recharge into the aquifer
      aqu_d(iaq)%no3_rchg = ob(icmd)%hin%no3 / ob(icmd)%area_ha
      aqu_d(iaq)%no3_st = aqu_d(iaq)%no3_st + aqu_d(iaq)%no3_rchg
      aqu_prm(iaq)%rchrgn_prev = aqu_d(iaq)%no3_rchg
      
      !! compute nitrate return flow out of aquifer
      if (aqu_d(iaq)%stor > 1.e-6) then
        !! (kg/ha / mm)
        conc_no3 = aqu_d(iaq)%no3_st / aqu_d(iaq)%stor
      else
        conc_no3 = 0.
      endif
      !! kg = (kg/ha / mm) * mm * ha
      ob(icmd)%hd(1)%no3 = (conc_no3 * aqu_d(iaq)%flo) * ob(icmd)%area_ha
      ob(icmd)%hd(1)%no3 = amin1(ob(icmd)%hd(1)%no3, (aqu_d(iaq)%no3_st * ob(icmd)%area_ha))
      aqu_d(iaq)%no3_lat = ob(icmd)%hd(1)%no3 / ob(icmd)%area_ha
      aqu_d(iaq)%no3_st = aqu_d(iaq)%no3_st - aqu_d(iaq)%no3_lat
      
      !revapno3 = conc * revap -- dont include nitrate uptake by plant
      
      !! compute NO3 lost in the aquifer
      no3_init = aqu_d(iaq)%no3_st
      aqu_d(iaq)%no3_st = aqu_d(iaq)%no3_st * aqu_prm(iaq)%nloss
      aqu_d(iaq)%no3_loss = no3_init - aqu_d(iaq)%no3_st
      
      !! compute nitrate seepage out of aquifer
      !! kg/ha = (kg/ha / mm) * mm
      aqu_d(iaq)%no3_seep = conc_no3 * aqu_d(iaq)%seep
      aqu_d(iaq)%no3_seep = amin1(aqu_d(iaq)%no3_seep, aqu_d(iaq)%no3_st)
      aqu_d(iaq)%no3_st = aqu_d(iaq)%no3_st - aqu_d(iaq)%no3_seep
      ob(icmd)%hd(2)%no3 = aqu_d(iaq)%no3_seep * ob(icmd)%area_ha
      
      !! compute mineral p flow (constant concentration) from aquifer - m^3 * ppm * 1000 kg/m^3 = 1/1000
      aqu_d(iaq)%minp = ob(icmd)%hin%flo * aqu_dat(iaq)%minp / 1000.
      ob(icmd)%hd(1)%solp = aqu_d(iaq)%minp
      
      !rtb salt
      !compute salt recharge into the aquifer
      do m=1,cs_db%num_salts
        salt_recharge = obcs(icmd)%hin(1)%salt(m) !kg
        cs_aqu(iaq)%salt(m) = cs_aqu(iaq)%salt(m) + salt_recharge !kg
        asaltb_d(iaq)%salt(m)%rchrg = salt_recharge
      enddo
      !compute groundwater salt loading and seepage
      do m=1,cs_db%num_salts
        !calculate new concentration of salt ion in groundwater
        gw_volume = (aqu_d(iaq)%stor/1000.) * (ob(icmd)%area_ha*10000.) !m3 of groundwater
        if(gw_volume.gt.0) then
          cs_aqu(iaq)%saltc(m) = (cs_aqu(iaq)%salt(m) * 1000.) / gw_volume !g/m3 = mg/L
        else
          cs_aqu(iaq)%saltc(m) = 0.
        endif
        !compute salt loading to streams
        gw_discharge = (aqu_d(iaq)%flo/1000.) * (ob(icmd)%area_ha*10000.) !mm --> m3
        salt_discharge = (cs_aqu(iaq)%saltc(m)*gw_discharge) / 1000. !kg
        !if loading is more than salt in aquifer, decrease accordingly and set storage = 0
        if(salt_discharge .gt. cs_aqu(iaq)%salt(m)) then
          salt_discharge = cs_aqu(iaq)%salt(m)
        endif
        cs_aqu(iaq)%salt(m) = cs_aqu(iaq)%salt(m) - salt_discharge !kg (update salt storage)
        obcs(icmd)%hd(1)%salt(m) = salt_discharge !kg (store salt loading, for input to streams)
        if (db_mx%aqu2d > 0) then !save to distribute on following day (if aqu2d method is used, with "aqu_cha.lin" file)
          aq_chcs(iaq)%hd(1)%salt(m) = obcs(icmd)%hd(1)%salt(m) !save to distribute on following day
        endif
        asaltb_d(iaq)%salt(m)%saltgw = obcs(icmd)%hd(1)%salt(m) !kg (store for daily output)
        !compute salt seepage out of aquifer
        gw_seep = (aqu_d(iaq)%seep/1000.) * (ob(icmd)%area_ha*10000.) !m3 of groundwater
        salt_seep = (cs_aqu(iaq)%saltc(m) * gw_seep) / 1000. !kg
        if(salt_seep.gt.cs_aqu(iaq)%salt(m)) then
          salt_seep = cs_aqu(iaq)%salt(m)
        endif
        cs_aqu(iaq)%salt(m) = cs_aqu(iaq)%salt(m) - salt_seep !kg (update salt storage)
        asaltb_d(iaq)%salt(m)%seep = salt_seep !kg (store for daily output)
        obcs(icmd)%hd(2)%salt(m) = asaltb_d(iaq)%salt(m)%seep
        !update salt ion concentration in groundwater        
        if(gw_volume.gt.0) then
          cs_aqu(iaq)%saltc(m) = (cs_aqu(iaq)%salt(m) * 1000.) / gw_volume !g/m3 = mg/L
        else
          cs_aqu(iaq)%saltc(m) = 0.
        endif
        asaltb_d(iaq)%salt(m)%mass = cs_aqu(iaq)%salt(m) !store mass for output
        asaltb_d(iaq)%salt(m)%conc = cs_aqu(iaq)%saltc(m) !store concentration for output
      enddo

      !rtb cs
      !compute constituent mass recharge into the aquifer
      do ics=1,cs_db%num_cs
        cs_recharge = obcs(icmd)%hin(1)%cs(ics) !kg
        cs_aqu(iaq)%cs(ics) = cs_aqu(iaq)%cs(ics) + cs_recharge !kg
        acsb_d(iaq)%cs(ics)%rchrg = cs_recharge
      enddo
      !compute groundwater constituent loading and seepage
      do ics=1,cs_db%num_cs
        !calculate new concentration of constituent in groundwater
        gw_volume = (aqu_d(iaq)%stor/1000.) * (ob(icmd)%area_ha*10000.) !m3 of groundwater
        if(gw_volume.gt.0) then
          cs_aqu(iaq)%csc(ics) = (cs_aqu(iaq)%cs(ics) * 1000.) / gw_volume !g/m3 = mg/L
        else
          cs_aqu(iaq)%csc(ics) = 0.
        endif
        !compute constituent loading to streams
        gw_discharge = (aqu_d(iaq)%flo/1000.) * (ob(icmd)%area_ha*10000.) !mm --> m3
        cs_discharge = (cs_aqu(iaq)%csc(ics)*gw_discharge) / 1000. !kg
        !if loading is more than constituent mass in aquifer, decrease accordingly and set storage = 0
        if(cs_discharge .gt. cs_aqu(iaq)%cs(ics)) then
          cs_discharge = cs_aqu(iaq)%cs(ics)
        endif
        cs_aqu(iaq)%cs(ics) = cs_aqu(iaq)%cs(ics) - cs_discharge !kg (update constituent mass storage)
        obcs(icmd)%hd(1)%cs(ics) = cs_discharge !kg (store constituent loading, for input to streams)
        if (db_mx%aqu2d > 0) then !save to distribute on following day (if aqu2d method is used, with "aqu_cha.lin" file)
          aq_chcs(iaq)%hd(1)%cs(ics) = obcs(icmd)%hd(1)%cs(ics) 
        endif
        acsb_d(iaq)%cs(ics)%csgw = obcs(icmd)%hd(1)%cs(ics) !kg (store for daily output)
        !compute constituent mass seepage out of aquifer
        gw_seep = (aqu_d(iaq)%seep/1000.) * (ob(icmd)%area_ha*10000.) !m3 of groundwater
        cs_seep = (cs_aqu(iaq)%csc(ics) * gw_seep) / 1000. !kg
        if(cs_seep.gt.cs_aqu(iaq)%cs(ics)) then
          cs_seep = cs_aqu(iaq)%cs(ics)
        endif
        cs_aqu(iaq)%cs(ics) = cs_aqu(iaq)%cs(ics) - cs_seep !kg (update constituent mass storage)
        acsb_d(iaq)%cs(ics)%seep = cs_seep !kg (store for daily output)
        obcs(icmd)%hd(2)%cs(ics) = acsb_d(iaq)%cs(ics)%seep
        !update constituent concentration in groundwater        
        if(gw_volume.gt.0) then
          cs_aqu(iaq)%csc(ics) = (cs_aqu(iaq)%cs(ics) * 1000.) / gw_volume !g/m3 = mg/L
        else
          cs_aqu(iaq)%csc(ics) = 0.
        endif
        acsb_d(iaq)%cs(ics)%mass = cs_aqu(iaq)%cs(ics)  !store mass for output
        acsb_d(iaq)%cs(ics)%conc = cs_aqu(iaq)%csc(ics) !store concentration for output
      enddo
      
      !! compute mineral p flow (constant concentration) from aquifer - m^3 * ppm * 1000 kg/m^3 = 1/1000
      aqu_d(iaq)%minp = ob(icmd)%hin%flo * aqu_dat(iaq)%minp / 1000.
      ob(icmd)%hd(1)%solp = aqu_d(iaq)%minp
      
      !! temperature of aquifer flow
      !ob(icmd)%hd(1)%temp = w_temp%gw

      !! compute fraction of flow to each channel in the aquifer
      !! if connected to aquifer - add flow
      if (db_mx%aqu2d > 0) then
        contrib_len = aq_ch(iaq)%len_tot * aqu_d(iaq)%flo / aqu_dat(iaq)%bf_max
      
        !! find the first channel contributing
        icontrib = 0
        do icha = 1, aq_ch(iaq)%num_tot
          if (contrib_len >= aq_ch(iaq)%ch(icha)%len_left) then
            icontrib = icha
            contrib_len_left = aq_ch(iaq)%ch(icha)%len_left + aq_ch(iaq)%ch(icha)%len
            exit
          end if
        end do
        !! set fractions for flow to each channel
        do icha = 1, aq_ch(iaq)%num_tot
          if (icha >= icontrib .and. icontrib > 0) then
            aq_ch(iaq)%ch(icha)%flo_fr = aq_ch(iaq)%ch(icha)%len / contrib_len_left
          else
            aq_ch(iaq)%ch(icha)%flo_fr = 0.
          end if
        end do
        !! save hydrographs to distribute on following day
        aq_ch(iaq)%hd = ob(icmd)%hd(1)
      end if

      !! compute pesticide transport and decay
      do ipest = 1, cs_db%num_pests
        ipest_db = cs_db%pest_num(ipest)
        
        !! set initial pesticide at start of day
        pest_init = cs_aqu(iaq)%pest(ipest)
        
        !! add incoming pesticide to storage
        cs_aqu(iaq)%pest(ipest) = cs_aqu(iaq)%pest(ipest) + obcs(icmd)%hin(1)%pest(ipest)
        
        !! compute pesticide decay in the aquifer
        aqupst_d(iaq)%pest(ipest)%react = 0.
        aqupst_d(iaq)%pest(ipest)%metab = 0.    ! zero metab for each pesticide
        if (cs_aqu(iaq)%pest(ipest) > 1.e-12) then
          if (bsn_prm%temp_decay == 1) then
            decay_t = decay_temp_adjust(pestdb(ipest_db)%aq_hlife, temp_aqu)
          else
            decay_t = pestcp(ipest_db)%decay_a
          end if
          aqupst_d(iaq)%pest(ipest)%react = cs_aqu(iaq)%pest(ipest) * (1. - decay_t)
          cs_aqu(iaq)%pest(ipest) =  cs_aqu(iaq)%pest(ipest) * decay_t
          !! add decay to daughter pesticides
          do imeta = 1, pestcp(ipest_db)%num_metab
            ipseq = pestcp(ipest_db)%daughter(imeta)%num
            ipdb = cs_db%pest_num(ipseq)
            mol_wt_rto = pestdb(ipdb)%mol_wt / pestdb(ipest_db)%mol_wt
            metab_decay = aqupst_d(iaq)%pest(ipest)%react * pestcp(ipest_db)%daughter(imeta)%soil_fr * mol_wt_rto  ! compute increment
            aqupst_d(iaq)%pest(ipseq)%metab = aqupst_d(iaq)%pest(ipseq)%metab + metab_decay  ! accumulate for output
            cs_aqu(iaq)%pest(ipseq) = cs_aqu(iaq)%pest(ipseq) + metab_decay  !! add increment only
          end do
        end if
            
        !! compute pesticide concentrations considering groundwater mixing factor
        !! behavior where concentration is based on a scaled aquifer mixing volume
        flow_mm = aqu_d(iaq)%stor * bsn_prm%pestgwfact + aqu_d(iaq)%flo + aqu_d(iaq)%revap + aqu_d(iaq)%seep
        if (flow_mm > 0.) then
          conc = cs_aqu(iaq)%pest(ipest) / flow_mm
        else
          conc = 0.
        end if
        if (conc < 1.e-9) conc = 0.

        !! route only return flow and seepage pesticide mass; revap pesticide is not routed
        obcs(icmd)%hd(1)%pest(ipest) = conc * aqu_d(iaq)%flo
        obcs(icmd)%hd(2)%pest(ipest) = conc * aqu_d(iaq)%seep
        obcs(icmd)%hd(1)%pest(ipest) = amax1(0., obcs(icmd)%hd(1)%pest(ipest))
        obcs(icmd)%hd(2)%pest(ipest) = amax1(0., obcs(icmd)%hd(2)%pest(ipest))

        !! remove exported pesticide from aquifer storage (cap at available mass)
        pest_kg = obcs(icmd)%hd(1)%pest(ipest) + obcs(icmd)%hd(2)%pest(ipest)
        if (pest_kg > cs_aqu(iaq)%pest(ipest)) then
          if (pest_kg > 0.) then
            obcs(icmd)%hd(1)%pest(ipest) = obcs(icmd)%hd(1)%pest(ipest) * cs_aqu(iaq)%pest(ipest) / pest_kg
            obcs(icmd)%hd(2)%pest(ipest) = obcs(icmd)%hd(2)%pest(ipest) * cs_aqu(iaq)%pest(ipest) / pest_kg
          else
            obcs(icmd)%hd(1)%pest(ipest) = 0.
            obcs(icmd)%hd(2)%pest(ipest) = 0.
          end if
          pest_kg = cs_aqu(iaq)%pest(ipest)
        end if
        cs_aqu(iaq)%pest(ipest) = cs_aqu(iaq)%pest(ipest) - pest_kg
        cs_aqu(iaq)%pest(ipest) = amax1(0., cs_aqu(iaq)%pest(ipest))
      
        !! set pesticide output variables - kg
        aqupst_d(iaq)%pest(ipest)%tot_in = obcs(icmd)%hin(1)%pest(ipest)
        !! assume frsol = 1 (all soluble)
        aqupst_d(iaq)%pest(ipest)%sol_flo = obcs(icmd)%hd(1)%pest(ipest)
        aqupst_d(iaq)%pest(ipest)%sor_flo = 0.      !! all soluble - may add later
        aqupst_d(iaq)%pest(ipest)%sol_perc = obcs(icmd)%hd(2)%pest(ipest)
        aqupst_d(iaq)%pest(ipest)%stor_ave = cs_aqu(iaq)%pest(ipest)
        aqupst_d(iaq)%pest(ipest)%stor_init = pest_init
        aqupst_d(iaq)%pest(ipest)%stor_final = cs_aqu(iaq)%pest(ipest)
      end do
        
      !! compute outflow objects (flow to channels, reservoirs, or aquifer)
      !! if flow from hru is directly routed
      iob_out = icmd
      aqu_d(iaq)%flo_cha = 0.
      aqu_d(iaq)%flo_res = 0.
      aqu_d(iaq)%flo_ls = 0.
      do iout = 1, ob(iob_out)%src_tot
        !! sum outflow to channels, reservoirs and other aquifers
        if (ob(iob_out)%htyp_out(iout) == "tot") then
          select case (ob(iob_out)%obtyp_out(iout))
          case ("cha")
            aqu_d(iaq)%flo_cha = aqu_d(iaq)%flo_cha + aqu_d(iaq)%flo * ob(iob_out)%frac_out(iout)
          case ("sdc")
            aqu_d(iaq)%flo_cha = aqu_d(iaq)%flo_cha + aqu_d(iaq)%flo * ob(iob_out)%frac_out(iout)
          case ("res")
            aqu_d(iaq)%flo_res = aqu_d(iaq)%flo_res + aqu_d(iaq)%flo * ob(iob_out)%frac_out(iout)
          case ("aqu")
            aqu_d(iaq)%flo_ls = aqu_d(iaq)%flo_ls + aqu_d(iaq)%flo * ob(iob_out)%frac_out(iout)
          end select
        end if
      end do

      !! total ingoing and outgoing (retuen flow + percolation) for output to SWIFT
      ob(icmd)%hin_tot = ob(icmd)%hin_tot + ob(icmd)%hin
      ob(icmd)%hout_tot = ob(icmd)%hout_tot + ob(icmd)%hd(1) + ob(icmd)%hd(2)
        
      !if (time%step > 0) then
        do ii = 1, time%step
          step = real(time%step)
          ob(icmd)%ts(1,ii) = ob(icmd)%hd(1) / step
        end do
      !end if

      return
      end subroutine aqu_1d_control